C13H19N — CID 88575967
(3E,6Z)-4-ethyl-N-methyl-5-methylidenenona-3,6,8-trien-2-imine (PubChem CID 88575967) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (3E,6Z)-4-ethyl-N-methyl-5-methylidenenona-3,6,8-trien-2-imine.
| Compound Name | (3E,6Z)-4-ethyl-N-methyl-5-methylidenenona-3,6,8-trien-2-imine |
|---|---|
| PubChem CID | 88575967 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (3E,6Z)-4-ethyl-N-methyl-5-methylidenenona-3,6,8-trien-2-imine |
| SMILES | C=C/C=C\C(=C)/C(=C/C(C)=N/C)CC |
| InChI | InChI=1S/C13H19N/c1-6-8-9-11(3)13(7-2)10-12(4)14-5/h6,8-10H,1,3,7H2,2,4-5H3/b9-8-,13-10+,14-12+ |
| InChIKey | FXKRLFSXCBGRKX-PBWOBLCBSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|