C10H15F3O — CID 88576082
2,5-dimethyl-3-(2,2,2-trifluoroethoxy)hexa-2,4-diene (PubChem CID 88576082) has the molecular formula C10H15F3O and a molecular weight of 208.22 g/mol. Its IUPAC name is 2,5-dimethyl-3-(2,2,2-trifluoroethoxy)hexa-2,4-diene.
| Compound Name | 2,5-dimethyl-3-(2,2,2-trifluoroethoxy)hexa-2,4-diene |
|---|---|
| PubChem CID | 88576082 |
| Molecular Formula | C10H15F3O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2,5-dimethyl-3-(2,2,2-trifluoroethoxy)hexa-2,4-diene |
| SMILES | CC(C)=CC(OCC(F)(F)F)=C(C)C |
| InChI | InChI=1S/C10H15F3O/c1-7(2)5-9(8(3)4)14-6-10(11,12)13/h5H,6H2,1-4H3 |
| InChIKey | UBBPCAAZOJFUFC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|