C26H25N7O2 — CID 88576132
[4-[4-[6-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-1H-indazol-3-yl]triazol-1-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 88576132) has the molecular formula C26H25N7O2 and a molecular weight of 467.53 g/mol. Its IUPAC name is [4-[4-[6-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-1H-indazol-3-yl]triazol-1-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[4-[6-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-1H-indazol-3-yl]triazol-1-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 88576132 |
| Molecular Formula | C26H25N7O2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | [4-[4-[6-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-1H-indazol-3-yl]triazol-1-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | C=C/C=C(\C=C/N)c1ccc2c(-c3cn(-c4ccc(C(=O)N5CCOCC5)cc4)nn3)n[nH]c2c1 |
| InChI | InChI=1S/C26H25N7O2/c1-2-3-18(10-11-27)20-6-9-22-23(16-20)28-30-25(22)24-17-33(31-29-24)21-7-4-19(5-8-21)26(34)32-12-14-35-15-13-32/h2-11,16-17H,1,12-15,27H2,(H,28,30)/b11-10-,18-3+ |
| InChIKey | FUBPEFPZPYAMJV-MMKMEQLLSA-N |
| XLogP | 3.32 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|