C22H28O7 — CID 88576283
(1S,4S,8R,9R,16S,21R)-6,11-dihydroxy-3,18,18,21-tetramethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-one (PubChem CID 88576283) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is (1S,4S,8R,9R,16S,21R)-6,11-dihydroxy-3,18,18,21-tetramethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-one.
| Compound Name | (1S,4S,8R,9R,16S,21R)-6,11-dihydroxy-3,18,18,21-tetramethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-one |
|---|---|
| PubChem CID | 88576283 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (1S,4S,8R,9R,16S,21R)-6,11-dihydroxy-3,18,18,21-tetramethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-one |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C4COC(O)O[C@H]4[C@@]24OC(O)O[C@@H]14)C1C(C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C22H28O7/c1-9-7-21-10(2)5-13-14(20(13,3)4)12(15(21)23)6-11-8-26-18(24)28-17(11)22(21)16(9)27-19(25)29-22/h6-7,10,12-14,16-19,24-25H,5,8H2,1-4H3/t10-,12+,13?,14?,16+,17-,18?,19?,21+,22-/m1/s1 |
| InChIKey | WWDRNPXAOBIBPF-LWAMAOMVSA-N |
| XLogP | 1.49 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|