About [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate
[(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate (PubChem CID 88576389) has the molecular formula C11H20INO4
and a molecular weight of 357.19 g/mol. Its IUPAC name is [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate.
Molecular Properties
| Compound Name | [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate |
| PubChem CID | 88576389 |
| Molecular Formula | C11H20INO4 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate |
| SMILES | CC[C@H](N)[C@@H](OC(C)=O)[C@H](OC(C)=O)C(C)I |
| InChI | InChI=1S/C11H20INO4/c1-5-9(13)11(17-8(4)15)10(6(2)12)16-7(3)14/h6,9-11H,5,13H2,1-4H3/t6?,9-,10+,11+/m0/s1 |
| InChIKey | CZTKKWJXXQPYFZ-GUZYOMIZSA-N |
| XLogP | 1.41 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate?
The IUPAC name of [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate (CID 88576389) is [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate.
What is the SMILES notation for [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate?
The canonical SMILES for [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate is CC[C@H](N)[C@@H](OC(C)=O)[C@H](OC(C)=O)C(C)I.
What is the InChIKey of [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate?
The InChIKey is CZTKKWJXXQPYFZ-GUZYOMIZSA-N. The full InChI is InChI=1S/C11H20INO4/c1-5-9(13)11(17-8(4)15)10(6(2)12)16-7(3)14/h6,9-11H,5,13H2,1-4H3/t6?,9-,10+,11+/m0/s1.
What are the key properties of [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate?
[(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate has a molecular weight of 357.19 g/mol, XLogP of 1.41, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R,5S)-4-acetyloxy-5-amino-2-iodoheptan-3-yl] acetate is sourced from PubChem (CID 88576389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).