C23H27N3O3 — CID 88576453
(E)-3-[4-[[2-hydroxyethyl-[2-(1H-indol-2-yl)ethyl]amino]methyl]phenyl]-N-methoxyprop-2-enamide (PubChem CID 88576453) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is (E)-3-[4-[[2-hydroxyethyl-[2-(1H-indol-2-yl)ethyl]amino]methyl]phenyl]-N-methoxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[2-hydroxyethyl-[2-(1H-indol-2-yl)ethyl]amino]methyl]phenyl]-N-methoxyprop-2-enamide |
|---|---|
| PubChem CID | 88576453 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (E)-3-[4-[[2-hydroxyethyl-[2-(1H-indol-2-yl)ethyl]amino]methyl]phenyl]-N-methoxyprop-2-enamide |
| SMILES | CONC(=O)/C=C/c1ccc(CN(CCO)CCc2cc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C23H27N3O3/c1-29-25-23(28)11-10-18-6-8-19(9-7-18)17-26(14-15-27)13-12-21-16-20-4-2-3-5-22(20)24-21/h2-11,16,24,27H,12-15,17H2,1H3,(H,25,28)/b11-10+ |
| InChIKey | GGRCUKRWWXUEKP-ZHACJKMWSA-N |
| XLogP | 2.90 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|