About N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide
N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 885766) has the molecular formula C11H12ClF3N2O
and a molecular weight of 280.68 g/mol. Its IUPAC name is N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide |
| PubChem CID | 885766 |
| Molecular Formula | C11H12ClF3N2O |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H12ClF3N2O/c1-10(2,3)9(18)17-8-7(12)4-6(5-16-8)11(13,14)15/h4-5H,1-3H3,(H,16,17,18) |
| InChIKey | RINSWVRUQUGXJI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide (CID 885766) is N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1ncc(C(F)(F)F)cc1Cl.
What is the InChIKey of N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide?
The InChIKey is RINSWVRUQUGXJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClF3N2O/c1-10(2,3)9(18)17-8-7(12)4-6(5-16-8)11(13,14)15/h4-5H,1-3H3,(H,16,17,18).
What are the key properties of N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide?
N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide has a molecular weight of 280.68 g/mol, XLogP of 3.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 885766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).