C8H14N2 — CID 88576674
(1Z,3Z)-N'-methyl-5-methylidenehexa-1,3-diene-1,6-diamine (PubChem CID 88576674) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (1Z,3Z)-N'-methyl-5-methylidenehexa-1,3-diene-1,6-diamine.
| Compound Name | (1Z,3Z)-N'-methyl-5-methylidenehexa-1,3-diene-1,6-diamine |
|---|---|
| PubChem CID | 88576674 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (1Z,3Z)-N'-methyl-5-methylidenehexa-1,3-diene-1,6-diamine |
| SMILES | C=C(/C=C\C=C/N)CNC |
| InChI | InChI=1S/C8H14N2/c1-8(7-10-2)5-3-4-6-9/h3-6,10H,1,7,9H2,2H3/b5-3-,6-4- |
| InChIKey | UZQHHECPLPXCCW-GLIMQPGKSA-N |
| XLogP | 0.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|