C23H33FN2O — CID 88576754
1-[(2E)-4-(cyclopropylmethoxy)penta-2,4-dien-2-yl]-4-[(3E)-3-ethenyl-5-fluoro-6-methylhepta-1,3,5-trien-2-yl]piperazine (PubChem CID 88576754) has the molecular formula C23H33FN2O and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-[(2E)-4-(cyclopropylmethoxy)penta-2,4-dien-2-yl]-4-[(3E)-3-ethenyl-5-fluoro-6-methylhepta-1,3,5-trien-2-yl]piperazine.
| Compound Name | 1-[(2E)-4-(cyclopropylmethoxy)penta-2,4-dien-2-yl]-4-[(3E)-3-ethenyl-5-fluoro-6-methylhepta-1,3,5-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 88576754 |
| Molecular Formula | C23H33FN2O |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 1-[(2E)-4-(cyclopropylmethoxy)penta-2,4-dien-2-yl]-4-[(3E)-3-ethenyl-5-fluoro-6-methylhepta-1,3,5-trien-2-yl]piperazine |
| SMILES | C=C/C(=C\C(F)=C(C)C)C(=C)N1CCN(/C(C)=C/C(=C)OCC2CC2)CC1 |
| InChI | InChI=1S/C23H33FN2O/c1-7-22(15-23(24)17(2)3)20(6)26-12-10-25(11-13-26)18(4)14-19(5)27-16-21-8-9-21/h7,14-15,21H,1,5-6,8-13,16H2,2-4H3/b18-14+,22-15+ |
| InChIKey | WZXGOKCEEUIARF-SDPONSEZSA-N |
| XLogP | 5.34 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|