C17H18F18O4 — CID 88576781
2-fluoro-3-methyl-2-(trifluoromethyl)-3-[1,1,2-trifluoro-3-methyl-3-(1,1,2,2,3,4,4,5-octafluoro-1-hydroxypentan-3-yl)oxy-2-(trifluoromethyl)butoxy]butan-1-ol (PubChem CID 88576781) has the molecular formula C17H18F18O4 and a molecular weight of 628.29 g/mol. Its IUPAC name is 2-fluoro-3-methyl-2-(trifluoromethyl)-3-[1,1,2-trifluoro-3-methyl-3-(1,1,2,2,3,4,4,5-octafluoro-1-hydroxypentan-3-yl)oxy-2-(trifluoromethyl)butoxy]butan-1-ol.
| Compound Name | 2-fluoro-3-methyl-2-(trifluoromethyl)-3-[1,1,2-trifluoro-3-methyl-3-(1,1,2,2,3,4,4,5-octafluoro-1-hydroxypentan-3-yl)oxy-2-(trifluoromethyl)butoxy]butan-1-ol |
|---|---|
| PubChem CID | 88576781 |
| Molecular Formula | C17H18F18O4 |
| Molecular Weight | 628.29 g/mol |
| Exact Mass | 628.09 |
| IUPAC Name | 2-fluoro-3-methyl-2-(trifluoromethyl)-3-[1,1,2-trifluoro-3-methyl-3-(1,1,2,2,3,4,4,5-octafluoro-1-hydroxypentan-3-yl)oxy-2-(trifluoromethyl)butoxy]butan-1-ol |
| SMILES | CC(C)(OC(F)(F)C(F)(C(F)(F)F)C(C)(C)OC(F)(C(F)(F)CF)C(F)(F)C(O)(F)F)C(F)(CO)C(F)(F)F |
| InChI | InChI=1S/C17H18F18O4/c1-7(2,9(19,6-36)14(26,27)28)39-17(34,35)11(22,15(29,30)31)8(3,4)38-13(25,10(20,21)5-18)12(23,24)16(32,33)37/h36-37H,5-6H2,1-4H3 |
| InChIKey | PSMJMBWBVDHMLD-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.29 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|