C15H20F6N2O8S2 — CID 88576841
1,1,2,2,3,3-hexafluoro-3-[4-(2-hydroxy-6-methyl-5-oxohept-6-enoyl)piperazin-1-yl]sulfonylpropane-1-sulfonic acid (PubChem CID 88576841) has the molecular formula C15H20F6N2O8S2 and a molecular weight of 534.45 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[4-(2-hydroxy-6-methyl-5-oxohept-6-enoyl)piperazin-1-yl]sulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[4-(2-hydroxy-6-methyl-5-oxohept-6-enoyl)piperazin-1-yl]sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88576841 |
| Molecular Formula | C15H20F6N2O8S2 |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[4-(2-hydroxy-6-methyl-5-oxohept-6-enoyl)piperazin-1-yl]sulfonylpropane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)CCC(O)C(=O)N1CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C15H20F6N2O8S2/c1-9(2)10(24)3-4-11(25)12(26)22-5-7-23(8-6-22)32(27,28)14(18,19)13(16,17)15(20,21)33(29,30)31/h11,25H,1,3-8H2,2H3,(H,29,30,31) |
| InChIKey | JNLMNCCVBRMZBL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|