C13H16F4O2 — CID 88576870
1-(4-butan-2-yl-2,3,5,6-tetrafluorophenoxy)propan-2-ol (PubChem CID 88576870) has the molecular formula C13H16F4O2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 1-(4-butan-2-yl-2,3,5,6-tetrafluorophenoxy)propan-2-ol.
| Compound Name | 1-(4-butan-2-yl-2,3,5,6-tetrafluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 88576870 |
| Molecular Formula | C13H16F4O2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-(4-butan-2-yl-2,3,5,6-tetrafluorophenoxy)propan-2-ol |
| SMILES | CCC(C)c1c(F)c(F)c(OCC(C)O)c(F)c1F |
| InChI | InChI=1S/C13H16F4O2/c1-4-6(2)8-9(14)11(16)13(12(17)10(8)15)19-5-7(3)18/h6-7,18H,4-5H2,1-3H3 |
| InChIKey | RHXSKHSXOAJYJI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|