C28H38BNO2 — CID 88577071
N-[4-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-4-yl]-1,1-diphenylmethanimine (PubChem CID 88577071) has the molecular formula C28H38BNO2 and a molecular weight of 431.43 g/mol. Its IUPAC name is N-[4-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-4-yl]-1,1-diphenylmethanimine.
| Compound Name | N-[4-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-4-yl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 88577071 |
| Molecular Formula | C28H38BNO2 |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | N-[4-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-4-yl]-1,1-diphenylmethanimine |
| SMILES | C=CCC(C)(CCCCB1OC(C)(C)C(C)(C)O1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H38BNO2/c1-7-20-28(6,21-14-15-22-29-31-26(2,3)27(4,5)32-29)30-25(23-16-10-8-11-17-23)24-18-12-9-13-19-24/h7-13,16-19H,1,14-15,20-22H2,2-6H3 |
| InChIKey | OHTGRSAHYLNQDI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|