About (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one
(3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one (PubChem CID 88577109) has the molecular formula C16H17BrO3
and a molecular weight of 337.21 g/mol. Its IUPAC name is (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one.
Molecular Properties
| Compound Name | (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one |
| PubChem CID | 88577109 |
| Molecular Formula | C16H17BrO3 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one |
| SMILES | O=C1C2(CO)CC(Br)C(CC2c2ccccc2)[C@@]12CO2 |
| InChI | InChI=1S/C16H17BrO3/c17-13-7-15(8-18)11(10-4-2-1-3-5-10)6-12(13)16(9-20-16)14(15)19/h1-5,11-13,18H,6-9H2/t11?,12?,13?,15?,16-/m0/s1 |
| InChIKey | KZJLJZAATALCKQ-DTLJHZKMSA-N |
| XLogP | 2.27 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one?
The IUPAC name of (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one (CID 88577109) is (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one.
What is the SMILES notation for (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one?
The canonical SMILES for (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one is O=C1C2(CO)CC(Br)C(CC2c2ccccc2)[C@@]12CO2.
What is the InChIKey of (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one?
The InChIKey is KZJLJZAATALCKQ-DTLJHZKMSA-N. The full InChI is InChI=1S/C16H17BrO3/c17-13-7-15(8-18)11(10-4-2-1-3-5-10)6-12(13)16(9-20-16)14(15)19/h1-5,11-13,18H,6-9H2/t11?,12?,13?,15?,16-/m0/s1.
What are the key properties of (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one?
(3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one has a molecular weight of 337.21 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-bromo-1-(hydroxymethyl)-7-phenylspiro[bicyclo[2.2.2]octane-3,2'-oxirane]-2-one is sourced from PubChem (CID 88577109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).