C13H17N5O5 — CID 88577211
N-[4-amino-7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]formamide (PubChem CID 88577211) has the molecular formula C13H17N5O5 and a molecular weight of 323.31 g/mol. Its IUPAC name is N-[4-amino-7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]formamide.
| Compound Name | N-[4-amino-7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]formamide |
|---|---|
| PubChem CID | 88577211 |
| Molecular Formula | C13H17N5O5 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[4-amino-7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]formamide |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1cc(NC=O)c2c(N)ncnc21 |
| InChI | InChI=1S/C13H17N5O5/c1-13(22)9(21)7(3-19)23-12(13)18-2-6(17-5-20)8-10(14)15-4-16-11(8)18/h2,4-5,7,9,12,19,21-22H,3H2,1H3,(H,17,20)(H2,14,15,16)/t7-,9-,12-,13-/m1/s1 |
| InChIKey | RKZAYUUTAZQAOE-NHULRPGXSA-N |
| XLogP | -1.42 |
| TPSA | 155.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|