C11H9ClFN3O2 — CID 88577317
3-amino-4-[5-[(chloroamino)methyl]-2-fluoroanilino]cyclobut-3-ene-1,2-dione (PubChem CID 88577317) has the molecular formula C11H9ClFN3O2 and a molecular weight of 269.66 g/mol. Its IUPAC name is 3-amino-4-[5-[(chloroamino)methyl]-2-fluoroanilino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[5-[(chloroamino)methyl]-2-fluoroanilino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 88577317 |
| Molecular Formula | C11H9ClFN3O2 |
| Molecular Weight | 269.66 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 3-amino-4-[5-[(chloroamino)methyl]-2-fluoroanilino]cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(Nc2cc(CNCl)ccc2F)c(=O)c1=O |
| InChI | InChI=1S/C11H9ClFN3O2/c12-15-4-5-1-2-6(13)7(3-5)16-9-8(14)10(17)11(9)18/h1-3,15-16H,4,14H2 |
| InChIKey | DBSFFYUKCJKYIZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.66 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|