About N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine
N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine (PubChem CID 88577414) has the molecular formula C9H14ClN3O
and a molecular weight of 215.68 g/mol. Its IUPAC name is N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine |
| PubChem CID | 88577414 |
| Molecular Formula | C9H14ClN3O |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine |
| SMILES | ClNCC1CCC(c2nnco2)CC1 |
| InChI | InChI=1S/C9H14ClN3O/c10-11-5-7-1-3-8(4-2-7)9-13-12-6-14-9/h6-8,11H,1-5H2 |
| InChIKey | CMOXVJZYHNSTRH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine?
The IUPAC name of N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine (CID 88577414) is N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine.
What is the SMILES notation for N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine?
The canonical SMILES for N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine is ClNCC1CCC(c2nnco2)CC1.
What is the InChIKey of N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine?
The InChIKey is CMOXVJZYHNSTRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN3O/c10-11-5-7-1-3-8(4-2-7)9-13-12-6-14-9/h6-8,11H,1-5H2.
What are the key properties of N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine?
N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine has a molecular weight of 215.68 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-chloro-1-[4-(1,3,4-oxadiazol-2-yl)cyclohexyl]methanamine is sourced from PubChem (CID 88577414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).