C16H36O8SSi3 — CID 88577632
[(2R,3R,4S,5R)-6-oxo-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl methanesulfonate (PubChem CID 88577632) has the molecular formula C16H36O8SSi3 and a molecular weight of 472.78 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-oxo-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl methanesulfonate.
| Compound Name | [(2R,3R,4S,5R)-6-oxo-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 88577632 |
| Molecular Formula | C16H36O8SSi3 |
| Molecular Weight | 472.78 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [(2R,3R,4S,5R)-6-oxo-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl methanesulfonate |
| SMILES | C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)O[C@@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C16H36O8SSi3/c1-25(18,19)20-11-12-13(22-26(2,3)4)14(23-27(5,6)7)15(16(17)21-12)24-28(8,9)10/h12-15H,11H2,1-10H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | KXYJATWBUQAWLJ-APIJFGDWSA-N |
| XLogP | 2.55 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.78 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|