C21H24IN5O3 — CID 88578347
2-N-iodo-4-[4-(oxan-4-yloxy)-1H-pyrazolo[4,3-c]pyridin-3-yl]-1-N-(oxolan-3-yl)benzene-1,2-diamine (PubChem CID 88578347) has the molecular formula C21H24IN5O3 and a molecular weight of 521.36 g/mol. Its IUPAC name is 2-N-iodo-4-[4-(oxan-4-yloxy)-1H-pyrazolo[4,3-c]pyridin-3-yl]-1-N-(oxolan-3-yl)benzene-1,2-diamine.
| Compound Name | 2-N-iodo-4-[4-(oxan-4-yloxy)-1H-pyrazolo[4,3-c]pyridin-3-yl]-1-N-(oxolan-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 88578347 |
| Molecular Formula | C21H24IN5O3 |
| Molecular Weight | 521.36 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 2-N-iodo-4-[4-(oxan-4-yloxy)-1H-pyrazolo[4,3-c]pyridin-3-yl]-1-N-(oxolan-3-yl)benzene-1,2-diamine |
| SMILES | INc1cc(-c2n[nH]c3ccnc(OC4CCOCC4)c23)ccc1NC1CCOC1 |
| InChI | InChI=1S/C21H24IN5O3/c22-25-18-11-13(1-2-16(18)24-14-4-8-29-12-14)20-19-17(26-27-20)3-7-23-21(19)30-15-5-9-28-10-6-15/h1-3,7,11,14-15,24-25H,4-6,8-10,12H2,(H,26,27) |
| InChIKey | SPTBJFXBZNXRBF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|