C9H18NO- — CID 88578410
(2S,5R)-2-ethyl-1-methanidyl-5-(methoxymethyl)pyrrolidine (PubChem CID 88578410) has the molecular formula C9H18NO- and a molecular weight of 156.25 g/mol. Its IUPAC name is (2S,5R)-2-ethyl-1-methanidyl-5-(methoxymethyl)pyrrolidine.
| Compound Name | (2S,5R)-2-ethyl-1-methanidyl-5-(methoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 88578410 |
| Molecular Formula | C9H18NO- |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | (2S,5R)-2-ethyl-1-methanidyl-5-(methoxymethyl)pyrrolidine |
| SMILES | [CH2-]N1[C@@H](COC)CC[C@@H]1CC |
| InChI | InChI=1S/C9H18NO/c1-4-8-5-6-9(7-11-3)10(8)2/h8-9H,2,4-7H2,1,3H3/q-1/t8-,9+/m0/s1 |
| InChIKey | WFOVXLBIACECAN-DTWKUNHWSA-N |
| XLogP | 1.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|