About 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate
2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate (PubChem CID 88578447) has the molecular formula C20H45NO8P2
and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate.
Molecular Properties
| Compound Name | 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate |
| PubChem CID | 88578447 |
| Molecular Formula | C20H45NO8P2 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OCCNCCOP(=O)(OC(C)(C)C)OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C20H45NO8P2/c1-17(2,3)26-30(22,27-18(4,5)6)24-15-13-21-14-16-25-31(23,28-19(7,8)9)29-20(10,11)12/h21H,13-16H2,1-12H3 |
| InChIKey | MIKUUQLLQQKSMK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate?
The IUPAC name of 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate (CID 88578447) is 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate.
What is the SMILES notation for 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate?
The canonical SMILES for 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate is CC(C)(C)OP(=O)(OCCNCCOP(=O)(OC(C)(C)C)OC(C)(C)C)OC(C)(C)C.
What is the InChIKey of 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate?
The InChIKey is MIKUUQLLQQKSMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H45NO8P2/c1-17(2,3)26-30(22,27-18(4,5)6)24-15-13-21-14-16-25-31(23,28-19(7,8)9)29-20(10,11)12/h21H,13-16H2,1-12H3.
What are the key properties of 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate?
2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate has a molecular weight of 489.53 g/mol, XLogP of 6.09, 12 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethylamino]ethyl ditert-butyl phosphate is sourced from PubChem (CID 88578447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).