C7H5F3N2O2S — CID 88578657
3,3,3-trifluoro-N-(5-formyl-1,3-thiazol-2-yl)propanamide (PubChem CID 88578657) has the molecular formula C7H5F3N2O2S and a molecular weight of 238.19 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(5-formyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(5-formyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 88578657 |
| Molecular Formula | C7H5F3N2O2S |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 3,3,3-trifluoro-N-(5-formyl-1,3-thiazol-2-yl)propanamide |
| SMILES | O=Cc1cnc(NC(=O)CC(F)(F)F)s1 |
| InChI | InChI=1S/C7H5F3N2O2S/c8-7(9,10)1-5(14)12-6-11-2-4(3-13)15-6/h2-3H,1H2,(H,11,12,14) |
| InChIKey | XWWGLXNNOLITMS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|