C13H24N2 — CID 88578721
(3Z,6E,7Z)-6-ethylidene-1-N,2-dimethylnona-3,7-diene-1,5-diamine (PubChem CID 88578721) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (3Z,6E,7Z)-6-ethylidene-1-N,2-dimethylnona-3,7-diene-1,5-diamine.
| Compound Name | (3Z,6E,7Z)-6-ethylidene-1-N,2-dimethylnona-3,7-diene-1,5-diamine |
|---|---|
| PubChem CID | 88578721 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (3Z,6E,7Z)-6-ethylidene-1-N,2-dimethylnona-3,7-diene-1,5-diamine |
| SMILES | C/C=C\C(=C/C)C(N)/C=C\C(C)CNC |
| InChI | InChI=1S/C13H24N2/c1-5-7-12(6-2)13(14)9-8-11(3)10-15-4/h5-9,11,13,15H,10,14H2,1-4H3/b7-5-,9-8-,12-6+ |
| InChIKey | PFLONKQEBIJFLF-AOEWOUBCSA-N |
| XLogP | 2.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|