C13H19NS — CID 88578737
(3Z,6E,8Z,10Z)-3-methylsulfanyldodeca-3,6,8,10-tetraen-5-imine (PubChem CID 88578737) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is (3Z,6E,8Z,10Z)-3-methylsulfanyldodeca-3,6,8,10-tetraen-5-imine.
| Compound Name | (3Z,6E,8Z,10Z)-3-methylsulfanyldodeca-3,6,8,10-tetraen-5-imine |
|---|---|
| PubChem CID | 88578737 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (3Z,6E,8Z,10Z)-3-methylsulfanyldodeca-3,6,8,10-tetraen-5-imine |
| SMILES | [H]/N=C(/C=C(/CC)SC)\C=C\C=C/C=C\C |
| InChI | InChI=1S/C13H19NS/c1-4-6-7-8-9-10-12(14)11-13(5-2)15-3/h4,6-11,14H,5H2,1-3H3/b6-4-,8-7-,10-9+,13-11-,14-12+ |
| InChIKey | LHQHHJPTCUVQKB-ULIUFWIRSA-N |
| XLogP | 4.35 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|