C13H26N2S — CID 88578742
(4S,6Z,8E)-4-amino-8-(propylamino)deca-6,8-diene-3-thiol (PubChem CID 88578742) has the molecular formula C13H26N2S and a molecular weight of 242.43 g/mol. Its IUPAC name is (4S,6Z,8E)-4-amino-8-(propylamino)deca-6,8-diene-3-thiol.
| Compound Name | (4S,6Z,8E)-4-amino-8-(propylamino)deca-6,8-diene-3-thiol |
|---|---|
| PubChem CID | 88578742 |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (4S,6Z,8E)-4-amino-8-(propylamino)deca-6,8-diene-3-thiol |
| SMILES | C/C=C(\C=C/C[C@H](N)C(S)CC)NCCC |
| InChI | InChI=1S/C13H26N2S/c1-4-10-15-11(5-2)8-7-9-12(14)13(16)6-3/h5,7-8,12-13,15-16H,4,6,9-10,14H2,1-3H3/b8-7-,11-5+/t12-,13?/m0/s1 |
| InChIKey | DFRXVOPEMLSXHZ-UPOFVYAASA-N |
| XLogP | 2.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|