C11H12ClIN4O2 — CID 88578748
[(2S,5R)-5-(2-amino-4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methanol (PubChem CID 88578748) has the molecular formula C11H12ClIN4O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is [(2S,5R)-5-(2-amino-4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methanol.
| Compound Name | [(2S,5R)-5-(2-amino-4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 88578748 |
| Molecular Formula | C11H12ClIN4O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | [(2S,5R)-5-(2-amino-4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methanol |
| SMILES | Nc1nc(Cl)c2c(I)cn([C@H]3CC[C@@H](CO)O3)c2n1 |
| InChI | InChI=1S/C11H12ClIN4O2/c12-9-8-6(13)3-17(10(8)16-11(14)15-9)7-2-1-5(4-18)19-7/h3,5,7,18H,1-2,4H2,(H2,14,15,16)/t5-,7+/m0/s1 |
| InChIKey | ISAMPJIUGKDSFR-CAHLUQPWSA-N |
| XLogP | 1.94 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|