C12H19NS — CID 88578797
N-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]sulfanylbuta-1,3-dien-2-amine (PubChem CID 88578797) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is N-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]sulfanylbuta-1,3-dien-2-amine.
| Compound Name | N-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]sulfanylbuta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 88578797 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]sulfanylbuta-1,3-dien-2-amine |
| SMILES | C=C(NC)C(=C)SC(=C/C)/C(C)=C\C |
| InChI | InChI=1S/C12H19NS/c1-7-9(3)12(8-2)14-11(5)10(4)13-6/h7-8,13H,4-5H2,1-3,6H3/b9-7-,12-8+ |
| InChIKey | IACBQNNQOLJELP-ZUQSVMQASA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|