C9H13Cl2NS — CID 88578804
(3E,5E,7E)-2-amino-6,8-dichloronona-3,5,7-triene-1-thiol (PubChem CID 88578804) has the molecular formula C9H13Cl2NS and a molecular weight of 238.18 g/mol. Its IUPAC name is (3E,5E,7E)-2-amino-6,8-dichloronona-3,5,7-triene-1-thiol.
| Compound Name | (3E,5E,7E)-2-amino-6,8-dichloronona-3,5,7-triene-1-thiol |
|---|---|
| PubChem CID | 88578804 |
| Molecular Formula | C9H13Cl2NS |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | (3E,5E,7E)-2-amino-6,8-dichloronona-3,5,7-triene-1-thiol |
| SMILES | C/C(Cl)=C\C(Cl)=C/C=C/C(N)CS |
| InChI | InChI=1S/C9H13Cl2NS/c1-7(10)5-8(11)3-2-4-9(12)6-13/h2-5,9,13H,6,12H2,1H3/b4-2+,7-5+,8-3+ |
| InChIKey | UIANXFSDJVKGDE-WRYXOREZSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|