C10H17NS — CID 88578834
(4Z,6Z)-2-amino-5-methylnona-4,6,8-triene-1-thiol (PubChem CID 88578834) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is (4Z,6Z)-2-amino-5-methylnona-4,6,8-triene-1-thiol.
| Compound Name | (4Z,6Z)-2-amino-5-methylnona-4,6,8-triene-1-thiol |
|---|---|
| PubChem CID | 88578834 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (4Z,6Z)-2-amino-5-methylnona-4,6,8-triene-1-thiol |
| SMILES | C=C/C=C\C(C)=C/CC(N)CS |
| InChI | InChI=1S/C10H17NS/c1-3-4-5-9(2)6-7-10(11)8-12/h3-6,10,12H,1,7-8,11H2,2H3/b5-4-,9-6- |
| InChIKey | WTLUODLOCYCGGF-WXOLFVLTSA-N |
| XLogP | 2.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|