C9H12F2N2 — CID 88578837
(2E,4E)-4-(2,2-difluoroethylideneamino)hepta-2,4,6-trien-3-amine (PubChem CID 88578837) has the molecular formula C9H12F2N2 and a molecular weight of 186.20 g/mol. Its IUPAC name is (2E,4E)-4-(2,2-difluoroethylideneamino)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-4-(2,2-difluoroethylideneamino)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 88578837 |
| Molecular Formula | C9H12F2N2 |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (2E,4E)-4-(2,2-difluoroethylideneamino)hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(/N=C/C(F)F)C(\N)=C/C |
| InChI | InChI=1S/C9H12F2N2/c1-3-5-8(7(12)4-2)13-6-9(10)11/h3-6,9H,1,12H2,2H3/b7-4+,8-5+,13-6+ |
| InChIKey | UTXOCJAJNMNDJE-IPGAMMMTSA-N |
| XLogP | 2.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|