C10H16F3N — CID 88578859
(3E)-7,7,7-trifluoro-N,N,6-trimethylhepta-1,3-dien-3-amine (PubChem CID 88578859) has the molecular formula C10H16F3N and a molecular weight of 207.24 g/mol. Its IUPAC name is (3E)-7,7,7-trifluoro-N,N,6-trimethylhepta-1,3-dien-3-amine.
| Compound Name | (3E)-7,7,7-trifluoro-N,N,6-trimethylhepta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 88578859 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | (3E)-7,7,7-trifluoro-N,N,6-trimethylhepta-1,3-dien-3-amine |
| SMILES | C=C/C(=C\CC(C)C(F)(F)F)N(C)C |
| InChI | InChI=1S/C10H16F3N/c1-5-9(14(3)4)7-6-8(2)10(11,12)13/h5,7-8H,1,6H2,2-4H3/b9-7+ |
| InChIKey | SELZNNIIMVQVOI-VQHVLOKHSA-N |
| XLogP | 3.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|