C36H25N9O5S2 — CID 88579020
3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyano-3-phenylpyrazol-5-yl]diazenyl]-4-methyl-6-(2-sulfoanilino)-2-pyridinyl]amino]benzoic acid (PubChem CID 88579020) has the molecular formula C36H25N9O5S2 and a molecular weight of 727.79 g/mol. Its IUPAC name is 3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyano-3-phenylpyrazol-5-yl]diazenyl]-4-methyl-6-(2-sulfoanilino)-2-pyridinyl]amino]benzoic acid.
| Compound Name | 3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyano-3-phenylpyrazol-5-yl]diazenyl]-4-methyl-6-(2-sulfoanilino)-2-pyridinyl]amino]benzoic acid |
|---|---|
| PubChem CID | 88579020 |
| Molecular Formula | C36H25N9O5S2 |
| Molecular Weight | 727.79 g/mol |
| Exact Mass | 727.14 |
| IUPAC Name | 3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyano-3-phenylpyrazol-5-yl]diazenyl]-4-methyl-6-(2-sulfoanilino)-2-pyridinyl]amino]benzoic acid |
| SMILES | Cc1cc(Nc2cccc(C(=O)O)c2)nc(Nc2ccccc2S(=O)(=O)O)c1/N=N/c1c(C#N)c(-c2ccccc2)nn1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C36H25N9O5S2/c1-21-18-30(38-24-13-9-12-23(19-24)35(46)47)41-33(39-27-15-6-8-17-29(27)52(48,49)50)31(21)42-43-34-25(20-37)32(22-10-3-2-4-11-22)44-45(34)36-40-26-14-5-7-16-28(26)51-36/h2-19H,1H3,(H,46,47)(H2,38,39,41)(H,48,49,50)/b43-42+ |
| InChIKey | VUDIPBVATQTYRE-HBSCQBRPSA-N |
| XLogP | 8.57 |
| TPSA | 207.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.79 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|