C12H19F3O — CID 88579037
1,1,1-trifluoro-2,6-dimethyl-4-propan-2-ylidenehept-5-en-2-ol (PubChem CID 88579037) has the molecular formula C12H19F3O and a molecular weight of 236.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-2,6-dimethyl-4-propan-2-ylidenehept-5-en-2-ol.
| Compound Name | 1,1,1-trifluoro-2,6-dimethyl-4-propan-2-ylidenehept-5-en-2-ol |
|---|---|
| PubChem CID | 88579037 |
| Molecular Formula | C12H19F3O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1,1,1-trifluoro-2,6-dimethyl-4-propan-2-ylidenehept-5-en-2-ol |
| SMILES | CC(C)=CC(CC(C)(O)C(F)(F)F)=C(C)C |
| InChI | InChI=1S/C12H19F3O/c1-8(2)6-10(9(3)4)7-11(5,16)12(13,14)15/h6,16H,7H2,1-5H3 |
| InChIKey | ANYZSWVYDVGTED-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|