C26H26F4O8S2 — CID 88579039
2-[4-[1-[1-(6-ethenylnaphthalen-2-yl)oxybutoxy]ethyl]phenoxy]sulfonyl-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 88579039) has the molecular formula C26H26F4O8S2 and a molecular weight of 606.61 g/mol. Its IUPAC name is 2-[4-[1-[1-(6-ethenylnaphthalen-2-yl)oxybutoxy]ethyl]phenoxy]sulfonyl-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-[4-[1-[1-(6-ethenylnaphthalen-2-yl)oxybutoxy]ethyl]phenoxy]sulfonyl-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 88579039 |
| Molecular Formula | C26H26F4O8S2 |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 606.10 |
| IUPAC Name | 2-[4-[1-[1-(6-ethenylnaphthalen-2-yl)oxybutoxy]ethyl]phenoxy]sulfonyl-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | C=Cc1ccc2cc(OC(CCC)OC(C)c3ccc(OS(=O)(=O)C(F)(F)C(F)(F)S(=O)(=O)O)cc3)ccc2c1 |
| InChI | InChI=1S/C26H26F4O8S2/c1-4-6-24(37-23-14-11-20-15-18(5-2)7-8-21(20)16-23)36-17(3)19-9-12-22(13-10-19)38-40(34,35)26(29,30)25(27,28)39(31,32)33/h5,7-17,24H,2,4,6H2,1,3H3,(H,31,32,33) |
| InChIKey | QNCACCNCCCBUEU-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|