C19H33F3O2 — CID 88579058
(3-ethyl-6,6,6-trifluorohexan-3-yl) 2-tert-butyl-2,4-dimethylpent-3-enoate (PubChem CID 88579058) has the molecular formula C19H33F3O2 and a molecular weight of 350.47 g/mol. Its IUPAC name is (3-ethyl-6,6,6-trifluorohexan-3-yl) 2-tert-butyl-2,4-dimethylpent-3-enoate.
| Compound Name | (3-ethyl-6,6,6-trifluorohexan-3-yl) 2-tert-butyl-2,4-dimethylpent-3-enoate |
|---|---|
| PubChem CID | 88579058 |
| Molecular Formula | C19H33F3O2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (3-ethyl-6,6,6-trifluorohexan-3-yl) 2-tert-butyl-2,4-dimethylpent-3-enoate |
| SMILES | CCC(CC)(CCC(F)(F)F)OC(=O)C(C)(C=C(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H33F3O2/c1-9-18(10-2,11-12-19(20,21)22)24-15(23)17(8,13-14(3)4)16(5,6)7/h13H,9-12H2,1-8H3 |
| InChIKey | SRZFLILJCAZSMP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|