C15H5F11O4 — CID 88579428
[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] (2E,3Z)-2-(1,2-difluoroethylidene)-3,4-difluoro-5-hydroperoxyhexa-3,5-dienoate (PubChem CID 88579428) has the molecular formula C15H5F11O4 and a molecular weight of 458.18 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] (2E,3Z)-2-(1,2-difluoroethylidene)-3,4-difluoro-5-hydroperoxyhexa-3,5-dienoate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] (2E,3Z)-2-(1,2-difluoroethylidene)-3,4-difluoro-5-hydroperoxyhexa-3,5-dienoate |
|---|---|
| PubChem CID | 88579428 |
| Molecular Formula | C15H5F11O4 |
| Molecular Weight | 458.18 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] (2E,3Z)-2-(1,2-difluoroethylidene)-3,4-difluoro-5-hydroperoxyhexa-3,5-dienoate |
| SMILES | C=C(OO)/C(F)=C(F)\C(C(=O)Oc1c(F)c(F)c(C(F)(F)F)c(F)c1F)=C(\F)CF |
| InChI | InChI=1S/C15H5F11O4/c1-3(30-28)7(18)8(19)5(4(17)2-16)14(27)29-13-11(22)9(20)6(15(24,25)26)10(21)12(13)23/h28H,1-2H2/b5-4-,8-7- |
| InChIKey | BEOCGSHTRQEOAP-UTOQUPLUSA-N |
| XLogP | 5.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.18 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|