C9H14IN3 — CID 88579476
(1Z,3E)-4-ethenyl-5-hydrazinyl-3-iodo-2-methylhexa-1,3,5-trien-1-amine (PubChem CID 88579476) has the molecular formula C9H14IN3 and a molecular weight of 291.14 g/mol. Its IUPAC name is (1Z,3E)-4-ethenyl-5-hydrazinyl-3-iodo-2-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-4-ethenyl-5-hydrazinyl-3-iodo-2-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 88579476 |
| Molecular Formula | C9H14IN3 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | (1Z,3E)-4-ethenyl-5-hydrazinyl-3-iodo-2-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(C(=C)NN)=C(I)/C(C)=C\N |
| InChI | InChI=1S/C9H14IN3/c1-4-8(7(3)13-12)9(10)6(2)5-11/h4-5,13H,1,3,11-12H2,2H3/b6-5-,9-8+ |
| InChIKey | UGZAYPJTZZBPIL-UEPDSTOUSA-N |
| XLogP | 1.70 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|