C43H62FN5O5Si2 — CID 88579567
ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate (PubChem CID 88579567) has the molecular formula C43H62FN5O5Si2 and a molecular weight of 804.17 g/mol. Its IUPAC name is ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate.
| Compound Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate |
|---|---|
| PubChem CID | 88579567 |
| Molecular Formula | C43H62FN5O5Si2 |
| Molecular Weight | 804.17 g/mol |
| Exact Mass | 803.43 |
| IUPAC Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate |
| SMILES | C=C(OCC)c1c(C2CCC(C(F)C(=O)OCC)CC2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C43H62FN5O5Si2/c1-10-53-31(3)38-40(34-19-17-33(18-20-34)39(44)43(50)54-11-2)47-41-36(35-21-22-37(45-27-35)32-15-13-12-14-16-32)28-46-49(41)42(38)48(29-51-23-25-55(4,5)6)30-52-24-26-56(7,8)9/h12-16,21-22,27-28,33-34,39H,3,10-11,17-20,23-26,29-30H2,1-2,4-9H3 |
| InChIKey | XVZJPEYCDQAPEK-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 100.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.17 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|