C37H55FN6O4Si2 — CID 88579587
ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate (PubChem CID 88579587) has the molecular formula C37H55FN6O4Si2 and a molecular weight of 723.06 g/mol. Its IUPAC name is ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate.
| Compound Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate |
|---|---|
| PubChem CID | 88579587 |
| Molecular Formula | C37H55FN6O4Si2 |
| Molecular Weight | 723.06 g/mol |
| Exact Mass | 722.38 |
| IUPAC Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)C1CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4cnn(-c5ccccc5)c4)c3n2)CC1 |
| InChI | InChI=1S/C37H55FN6O4Si2/c1-8-48-37(45)35(38)29-16-14-28(15-17-29)33-22-34(42(26-46-18-20-49(2,3)4)27-47-19-21-50(5,6)7)44-36(41-33)32(24-40-44)30-23-39-43(25-30)31-12-10-9-11-13-31/h9-13,22-25,28-29,35H,8,14-21,26-27H2,1-7H3 |
| InChIKey | VKWYYSPQQDATCS-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 96.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.06 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|