C41H61FN6O5Si2 — CID 88579589
ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate (PubChem CID 88579589) has the molecular formula C41H61FN6O5Si2 and a molecular weight of 793.15 g/mol. Its IUPAC name is ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate.
| Compound Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate |
|---|---|
| PubChem CID | 88579589 |
| Molecular Formula | C41H61FN6O5Si2 |
| Molecular Weight | 793.15 g/mol |
| Exact Mass | 792.42 |
| IUPAC Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetate |
| SMILES | C=C(OCC)c1c(C2CCC(C(F)C(=O)OCC)CC2)nc2c(-c3cnn(-c4ccccc4)c3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C41H61FN6O5Si2/c1-10-52-30(3)36-38(32-19-17-31(18-20-32)37(42)41(49)53-11-2)45-39-35(33-25-43-47(27-33)34-15-13-12-14-16-34)26-44-48(39)40(36)46(28-50-21-23-54(4,5)6)29-51-22-24-55(7,8)9/h12-16,25-27,31-32,37H,3,10-11,17-24,28-29H2,1-2,4-9H3 |
| InChIKey | UXZAPALGMKZRDG-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 105.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.15 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|