C21H32N4 — CID 88579605
(1Z,3Z,5Z)-3-[3-[1-(dimethylamino)-2-methylbutan-2-yl]phenyl]-5-(prop-1-en-2-ylhydrazinylidene)penta-1,3-dien-1-amine (PubChem CID 88579605) has the molecular formula C21H32N4 and a molecular weight of 340.52 g/mol. Its IUPAC name is (1Z,3Z,5Z)-3-[3-[1-(dimethylamino)-2-methylbutan-2-yl]phenyl]-5-(prop-1-en-2-ylhydrazinylidene)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z,5Z)-3-[3-[1-(dimethylamino)-2-methylbutan-2-yl]phenyl]-5-(prop-1-en-2-ylhydrazinylidene)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 88579605 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | (1Z,3Z,5Z)-3-[3-[1-(dimethylamino)-2-methylbutan-2-yl]phenyl]-5-(prop-1-en-2-ylhydrazinylidene)penta-1,3-dien-1-amine |
| SMILES | C=C(C)N/N=C\C=C(\C=C/N)c1cccc(C(C)(CC)CN(C)C)c1 |
| InChI | InChI=1S/C21H32N4/c1-7-21(4,16-25(5)6)20-10-8-9-19(15-20)18(11-13-22)12-14-23-24-17(2)3/h8-15,24H,2,7,16,22H2,1,3-6H3/b13-11-,18-12-,23-14- |
| InChIKey | YSDBWVKXFLMWME-DCTIHFOLSA-N |
| XLogP | 3.88 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|