C57H58O11 — CID 88579684
4-[3,5-bis[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]phenyl]oxane (PubChem CID 88579684) has the molecular formula C57H58O11 and a molecular weight of 919.08 g/mol. Its IUPAC name is 4-[3,5-bis[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]phenyl]oxane.
| Compound Name | 4-[3,5-bis[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]phenyl]oxane |
|---|---|
| PubChem CID | 88579684 |
| Molecular Formula | C57H58O11 |
| Molecular Weight | 919.08 g/mol |
| Exact Mass | 918.40 |
| IUPAC Name | 4-[3,5-bis[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]phenyl]oxane |
| SMILES | COc1ccc(COc2cc(COc3cc(OCc4cc(OCc5ccc(OC)cc5)cc(OCc5ccc(OC)cc5)c4)cc(C4CCOCC4)c3)cc(OCc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C57H58O11/c1-58-48-13-5-40(6-14-48)34-63-52-25-44(26-53(31-52)64-35-41-7-15-49(59-2)16-8-41)38-67-56-29-47(46-21-23-62-24-22-46)30-57(33-56)68-39-45-27-54(65-36-42-9-17-50(60-3)18-10-42)32-55(28-45)66-37-43-11-19-51(61-4)20-12-43/h5-20,25-33,46H,21-24,34-39H2,1-4H3 |
| InChIKey | UBSHFMXETNUCDJ-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.08 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |