C17H24N2 — CID 88579793
2-[5-[(3Z)-4-methanimidoylhexa-1,3,5-trien-3-yl]cyclohexa-1,5-dien-1-yl]-2-methylpropan-1-amine (PubChem CID 88579793) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-[5-[(3Z)-4-methanimidoylhexa-1,3,5-trien-3-yl]cyclohexa-1,5-dien-1-yl]-2-methylpropan-1-amine.
| Compound Name | 2-[5-[(3Z)-4-methanimidoylhexa-1,3,5-trien-3-yl]cyclohexa-1,5-dien-1-yl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 88579793 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-[5-[(3Z)-4-methanimidoylhexa-1,3,5-trien-3-yl]cyclohexa-1,5-dien-1-yl]-2-methylpropan-1-amine |
| SMILES | [H]/N=C/C(C=C)=C(/C=C)C1=CC(C(C)(C)CN)=CCC1 |
| InChI | InChI=1S/C17H24N2/c1-5-13(11-18)16(6-2)14-8-7-9-15(10-14)17(3,4)12-19/h5-6,9-11,18H,1-2,7-8,12,19H2,3-4H3/b16-13-,18-11+ |
| InChIKey | QHKXVJLSAQRMRC-ZTZIGVKRSA-N |
| XLogP | 3.94 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|