C32H46F5NO2SSi — CID 88579814
tert-butyl-[(3R,9S)-7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane (PubChem CID 88579814) has the molecular formula C32H46F5NO2SSi and a molecular weight of 631.87 g/mol. Its IUPAC name is tert-butyl-[(3R,9S)-7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,9S)-7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 88579814 |
| Molecular Formula | C32H46F5NO2SSi |
| Molecular Weight | 631.87 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | tert-butyl-[(3R,9S)-7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(S(F)(F)(F)(F)F)cc1)OC31CCCC1)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)C2 |
| InChI | InChI=1S/C32H46F5NO2SSi/c1-20(2)28-26-27(25-23(38-28)18-31(6,7)19-24(25)40-42(8,9)30(3,4)5)32(16-10-11-17-32)39-29(26)21-12-14-22(15-13-21)41(33,34,35,36)37/h12-15,20,24,29H,10-11,16-19H2,1-9H3/t24-,29+/m0/s1 |
| InChIKey | NBDILJMEEDYYFX-PWUYWRBVSA-N |
| XLogP | 11.79 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.87 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|