C37H54BrN5O4Si2 — CID 88579931
ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-1-deuteriocyclohexyl]-2-deuterioacetate (PubChem CID 88579931) has the molecular formula C37H54BrN5O4Si2 and a molecular weight of 770.96 g/mol. Its IUPAC name is ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-1-deuteriocyclohexyl]-2-deuterioacetate.
| Compound Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-1-deuteriocyclohexyl]-2-deuterioacetate |
|---|---|
| PubChem CID | 88579931 |
| Molecular Formula | C37H54BrN5O4Si2 |
| Molecular Weight | 770.96 g/mol |
| Exact Mass | 769.30 |
| IUPAC Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-1-deuteriocyclohexyl]-2-deuterioacetate |
| SMILES | [2H]C(C(=O)OCC)C1([2H])CCC(c2nc3c(-c4cnc5ccccc5c4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2Br)CC1 |
| InChI | InChI=1S/C37H54BrN5O4Si2/c1-8-47-33(44)21-27-13-15-28(16-14-27)35-34(38)37(42(25-45-17-19-48(2,3)4)26-46-18-20-49(5,6)7)43-36(41-35)31(24-40-43)30-22-29-11-9-10-12-32(29)39-23-30/h9-12,22-24,27-28H,8,13-21,25-26H2,1-7H3/i21D,27D |
| InChIKey | KXNNKMDSGZNNGL-OIQVRXPZSA-N |
| XLogP | 9.36 |
| TPSA | 91.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.96 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|