About 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one
5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one (PubChem CID 88580189) has the molecular formula C12H10F6N2O
and a molecular weight of 312.21 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one.
Molecular Properties
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one |
| PubChem CID | 88580189 |
| Molecular Formula | C12H10F6N2O |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one |
| SMILES | CN1C(=O)NCC1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F6N2O/c1-20-9(5-19-10(20)21)6-2-7(11(13,14)15)4-8(3-6)12(16,17)18/h2-4,9H,5H2,1H3,(H,19,21) |
| InChIKey | LYNUEHJOQCMUFE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one?
The IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one (CID 88580189) is 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one.
What is the SMILES notation for 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one?
The canonical SMILES for 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one is CN1C(=O)NCC1c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one?
The InChIKey is LYNUEHJOQCMUFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F6N2O/c1-20-9(5-19-10(20)21)6-2-7(11(13,14)15)4-8(3-6)12(16,17)18/h2-4,9H,5H2,1H3,(H,19,21).
What are the key properties of 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one?
5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one has a molecular weight of 312.21 g/mol, XLogP of 3.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-2-one is sourced from PubChem (CID 88580189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).