C21H22N2OS — CID 88580193
4-(4-nitrosophenyl)-5-(3,4,5-triethylphenyl)-1,2-thiazole (PubChem CID 88580193) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 4-(4-nitrosophenyl)-5-(3,4,5-triethylphenyl)-1,2-thiazole.
| Compound Name | 4-(4-nitrosophenyl)-5-(3,4,5-triethylphenyl)-1,2-thiazole |
|---|---|
| PubChem CID | 88580193 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-(4-nitrosophenyl)-5-(3,4,5-triethylphenyl)-1,2-thiazole |
| SMILES | CCc1cc(-c2sncc2-c2ccc(N=O)cc2)cc(CC)c1CC |
| InChI | InChI=1S/C21H22N2OS/c1-4-14-11-17(12-15(5-2)19(14)6-3)21-20(13-22-25-21)16-7-9-18(23-24)10-8-16/h7-13H,4-6H2,1-3H3 |
| InChIKey | XHHTXWJNUIAPSF-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |