C34H45N3O4 — CID 88580456
2-[2-[4-ethyl-3-(4-morpholin-4-ylpiperidin-1-yl)phenyl]propan-2-yl]-3-(1-hydroperoxy-2,2-dimethylpropyl)-1-benzofuran-6-carbonitrile (PubChem CID 88580456) has the molecular formula C34H45N3O4 and a molecular weight of 559.75 g/mol. Its IUPAC name is 2-[2-[4-ethyl-3-(4-morpholin-4-ylpiperidin-1-yl)phenyl]propan-2-yl]-3-(1-hydroperoxy-2,2-dimethylpropyl)-1-benzofuran-6-carbonitrile.
| Compound Name | 2-[2-[4-ethyl-3-(4-morpholin-4-ylpiperidin-1-yl)phenyl]propan-2-yl]-3-(1-hydroperoxy-2,2-dimethylpropyl)-1-benzofuran-6-carbonitrile |
|---|---|
| PubChem CID | 88580456 |
| Molecular Formula | C34H45N3O4 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | 2-[2-[4-ethyl-3-(4-morpholin-4-ylpiperidin-1-yl)phenyl]propan-2-yl]-3-(1-hydroperoxy-2,2-dimethylpropyl)-1-benzofuran-6-carbonitrile |
| SMILES | CCc1ccc(C(C)(C)c2oc3cc(C#N)ccc3c2C(OO)C(C)(C)C)cc1N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C34H45N3O4/c1-7-24-9-10-25(21-28(24)37-14-12-26(13-15-37)36-16-18-39-19-17-36)34(5,6)32-30(31(41-38)33(2,3)4)27-11-8-23(22-35)20-29(27)40-32/h8-11,20-21,26,31,38H,7,12-19H2,1-6H3 |
| InChIKey | QPTRBPRBUYXOIF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|