C9H12Cl2N2O — CID 88580536
4,6-dichloro-5-(2-ethoxypropyl)pyrimidine (PubChem CID 88580536) has the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. Its IUPAC name is 4,6-dichloro-5-(2-ethoxypropyl)pyrimidine.
| Compound Name | 4,6-dichloro-5-(2-ethoxypropyl)pyrimidine |
|---|---|
| PubChem CID | 88580536 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 4,6-dichloro-5-(2-ethoxypropyl)pyrimidine |
| SMILES | CCOC(C)Cc1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C9H12Cl2N2O/c1-3-14-6(2)4-7-8(10)12-5-13-9(7)11/h5-6H,3-4H2,1-2H3 |
| InChIKey | IPGUIMUDXMKTOC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |