About 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide
2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide (PubChem CID 88580566) has the molecular formula C15H30FNO
and a molecular weight of 259.41 g/mol. Its IUPAC name is 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide.
Molecular Properties
| Compound Name | 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide |
| PubChem CID | 88580566 |
| Molecular Formula | C15H30FNO |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide |
| SMILES | CCCC(CF)(C(=O)N(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C15H30FNO/c1-8-9-15(10-16,11(2)3)14(18)17(12(4)5)13(6)7/h11-13H,8-10H2,1-7H3 |
| InChIKey | PTRCSOABKHFEQL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide?
The IUPAC name of 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide (CID 88580566) is 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide.
What is the SMILES notation for 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide?
The canonical SMILES for 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide is CCCC(CF)(C(=O)N(C(C)C)C(C)C)C(C)C.
What is the InChIKey of 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide?
The InChIKey is PTRCSOABKHFEQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30FNO/c1-8-9-15(10-16,11(2)3)14(18)17(12(4)5)13(6)7/h11-13H,8-10H2,1-7H3.
What are the key properties of 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide?
2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide has a molecular weight of 259.41 g/mol, XLogP of 4.04, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethyl)-N,N,2-tri(propan-2-yl)pentanamide is sourced from PubChem (CID 88580566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).